C18H25N2O6P — CID 175544920
[4-(6,7-dimethoxyquinazolin-4-yl)cyclohexyl] ethyl hydrogen phosphate (PubChem CID 175544920) has the molecular formula C18H25N2O6P and a molecular weight of 396.38 g/mol. Its IUPAC name is [4-(6,7-dimethoxyquinazolin-4-yl)cyclohexyl] ethyl hydrogen phosphate.
| Compound Name | [4-(6,7-dimethoxyquinazolin-4-yl)cyclohexyl] ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 175544920 |
| Molecular Formula | C18H25N2O6P |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [4-(6,7-dimethoxyquinazolin-4-yl)cyclohexyl] ethyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)OC1CCC(c2ncnc3cc(OC)c(OC)cc23)CC1 |
| InChI | InChI=1S/C18H25N2O6P/c1-4-25-27(21,22)26-13-7-5-12(6-8-13)18-14-9-16(23-2)17(24-3)10-15(14)19-11-20-18/h9-13H,4-8H2,1-3H3,(H,21,22) |
| InChIKey | WDYBUQWJRBDERP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|