C17H24N3O4P — CID 154672995
2-[4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]ethylphosphonous acid (PubChem CID 154672995) has the molecular formula C17H24N3O4P and a molecular weight of 365.37 g/mol. Its IUPAC name is 2-[4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]ethylphosphonous acid.
| Compound Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]ethylphosphonous acid |
|---|---|
| PubChem CID | 154672995 |
| Molecular Formula | C17H24N3O4P |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]ethylphosphonous acid |
| SMILES | COc1cc2ncnc(C3CCN(CCP(O)O)CC3)c2cc1OC |
| InChI | InChI=1S/C17H24N3O4P/c1-23-15-9-13-14(10-16(15)24-2)18-11-19-17(13)12-3-5-20(6-4-12)7-8-25(21)22/h9-12,21-22H,3-8H2,1-2H3 |
| InChIKey | VHGKRYPKOSKIRH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|