C16H22N3O6P — CID 162511263
[4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]methyl dihydrogen phosphate (PubChem CID 162511263) has the molecular formula C16H22N3O6P and a molecular weight of 383.34 g/mol. Its IUPAC name is [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]methyl dihydrogen phosphate.
| Compound Name | [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 162511263 |
| Molecular Formula | C16H22N3O6P |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]methyl dihydrogen phosphate |
| SMILES | COc1cc2ncnc(C3CCN(COP(=O)(O)O)CC3)c2cc1OC |
| InChI | InChI=1S/C16H22N3O6P/c1-23-14-7-12-13(8-15(14)24-2)17-9-18-16(12)11-3-5-19(6-4-11)10-25-26(20,21)22/h7-9,11H,3-6,10H2,1-2H3,(H2,20,21,22) |
| InChIKey | JAJOWDLHMQSEOK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|