C30H36N8O2 — CID 163400257
1-[7-[1-[[4-(5-aminoindazol-2-yl)cyclohexyl]methyl]piperidin-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 163400257) has the molecular formula C30H36N8O2 and a molecular weight of 540.67 g/mol. Its IUPAC name is 1-[7-[1-[[4-(5-aminoindazol-2-yl)cyclohexyl]methyl]piperidin-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[7-[1-[[4-(5-aminoindazol-2-yl)cyclohexyl]methyl]piperidin-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 163400257 |
| Molecular Formula | C30H36N8O2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 1-[7-[1-[[4-(5-aminoindazol-2-yl)cyclohexyl]methyl]piperidin-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | Nc1ccc2nn(C3CCC(CN4CCC(c5ccn6c(N7CCC(=O)NC7=O)cnc6c5)CC4)CC3)cc2c1 |
| InChI | InChI=1S/C30H36N8O2/c31-24-3-6-26-23(15-24)19-38(34-26)25-4-1-20(2-5-25)18-35-11-7-21(8-12-35)22-9-13-36-27(16-22)32-17-29(36)37-14-10-28(39)33-30(37)40/h3,6,9,13,15-17,19-21,25H,1-2,4-5,7-8,10-12,14,18,31H2,(H,33,39,40) |
| InChIKey | UZYKUXUUGLKCAP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|