C24H30FIN2O2S2 — CID 163402146
(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;[2-[(3R,6S)-6-methyloxan-3-yl]sulfanylethylamino] thiohypoiodite (PubChem CID 163402146) has the molecular formula C24H30FIN2O2S2 and a molecular weight of 588.55 g/mol. Its IUPAC name is (1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;[2-[(3R,6S)-6-methyloxan-3-yl]sulfanylethylamino] thiohypoiodite.
| Compound Name | (1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;[2-[(3R,6S)-6-methyloxan-3-yl]sulfanylethylamino] thiohypoiodite |
|---|---|
| PubChem CID | 163402146 |
| Molecular Formula | C24H30FIN2O2S2 |
| Molecular Weight | 588.55 g/mol |
| Exact Mass | 588.08 |
| IUPAC Name | (1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;[2-[(3R,6S)-6-methyloxan-3-yl]sulfanylethylamino] thiohypoiodite |
| SMILES | C[C@H]1CC[C@@H](SCCNSI)CO1.O=CN1CCc2ccccc2[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FNO.C8H16INOS2/c17-14-7-5-13(6-8-14)16-15-4-2-1-3-12(15)9-10-18(16)11-19;1-7-2-3-8(6-11-7)12-5-4-10-13-9/h1-8,11,16H,9-10H2;7-8,10H,2-6H2,1H3/t16-;7-,8+/m00/s1 |
| InChIKey | SBNXITDQODBING-OCNXMCDBSA-N |
| XLogP | 5.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|