C18H17ClN4O3S — CID 163403513
4-[2-chloro-4-(5-phenyl-1H-1,2,4-triazol-3-yl)phenyl]sulfonylmorpholine (PubChem CID 163403513) has the molecular formula C18H17ClN4O3S and a molecular weight of 404.88 g/mol. Its IUPAC name is 4-[2-chloro-4-(5-phenyl-1H-1,2,4-triazol-3-yl)phenyl]sulfonylmorpholine.
| Compound Name | 4-[2-chloro-4-(5-phenyl-1H-1,2,4-triazol-3-yl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 163403513 |
| Molecular Formula | C18H17ClN4O3S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 4-[2-chloro-4-(5-phenyl-1H-1,2,4-triazol-3-yl)phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc(-c2n[nH]c(-c3ccccc3)n2)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C18H17ClN4O3S/c19-15-12-14(18-20-17(21-22-18)13-4-2-1-3-5-13)6-7-16(15)27(24,25)23-8-10-26-11-9-23/h1-7,12H,8-11H2,(H,20,21,22) |
| InChIKey | HECDMPRJEOBRJV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |