C12H13N3O3S2 — CID 18346888
4-[(3-phenyl-1,2,4-thiadiazol-5-yl)sulfonyl]morpholine (PubChem CID 18346888) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-[(3-phenyl-1,2,4-thiadiazol-5-yl)sulfonyl]morpholine.
| Compound Name | 4-[(3-phenyl-1,2,4-thiadiazol-5-yl)sulfonyl]morpholine |
|---|---|
| PubChem CID | 18346888 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 4-[(3-phenyl-1,2,4-thiadiazol-5-yl)sulfonyl]morpholine |
| SMILES | O=S(=O)(c1nc(-c2ccccc2)ns1)N1CCOCC1 |
| InChI | InChI=1S/C12H13N3O3S2/c16-20(17,15-6-8-18-9-7-15)12-13-11(14-19-12)10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | JZPONVXOXBRQHP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |