C25H33ClN4O6 — CID 163405693
N-(10-aminodecyl)-N-chloro-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide (PubChem CID 163405693) has the molecular formula C25H33ClN4O6 and a molecular weight of 521.01 g/mol. Its IUPAC name is N-(10-aminodecyl)-N-chloro-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide.
| Compound Name | N-(10-aminodecyl)-N-chloro-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide |
|---|---|
| PubChem CID | 163405693 |
| Molecular Formula | C25H33ClN4O6 |
| Molecular Weight | 521.01 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | N-(10-aminodecyl)-N-chloro-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide |
| SMILES | NCCCCCCCCCCN(Cl)C(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H33ClN4O6/c26-29(15-8-6-4-2-1-3-5-7-14-27)21(32)16-36-19-11-9-10-17-22(19)25(35)30(24(17)34)18-12-13-20(31)28-23(18)33/h9-11,18H,1-8,12-16,27H2,(H,28,31,33) |
| InChIKey | HFDPZCDWTGMPEW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.01 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|