C14H29NO3Si — CID 163406223
[tert-butyl(dimethyl)silyl]oxymethyl 2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 163406223) has the molecular formula C14H29NO3Si and a molecular weight of 287.48 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl]oxymethyl 2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | [tert-butyl(dimethyl)silyl]oxymethyl 2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163406223 |
| Molecular Formula | C14H29NO3Si |
| Molecular Weight | 287.48 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | [tert-butyl(dimethyl)silyl]oxymethyl 2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC1(C)CCCN1C(=O)OCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H29NO3Si/c1-13(2,3)19(6,7)18-11-17-12(16)15-10-8-9-14(15,4)5/h8-11H2,1-7H3 |
| InChIKey | WAJOXIFCRNWLSX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|