C13H29NOSi — CID 163406218
tert-butyl-[(2,2-dimethylpyrrolidin-1-yl)methoxy]-dimethylsilane (PubChem CID 163406218) has the molecular formula C13H29NOSi and a molecular weight of 243.47 g/mol. Its IUPAC name is tert-butyl-[(2,2-dimethylpyrrolidin-1-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2,2-dimethylpyrrolidin-1-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 163406218 |
| Molecular Formula | C13H29NOSi |
| Molecular Weight | 243.47 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | tert-butyl-[(2,2-dimethylpyrrolidin-1-yl)methoxy]-dimethylsilane |
| SMILES | CC1(C)CCCN1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H29NOSi/c1-12(2,3)16(6,7)15-11-14-10-8-9-13(14,4)5/h8-11H2,1-7H3 |
| InChIKey | SYZARYXMMHCHTQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|