C20H39NO2 — CID 163408640
7-[(1S,2S)-2-(heptylamino)cyclohexyl]heptanoic acid (PubChem CID 163408640) has the molecular formula C20H39NO2 and a molecular weight of 325.54 g/mol. Its IUPAC name is 7-[(1S,2S)-2-(heptylamino)cyclohexyl]heptanoic acid.
| Compound Name | 7-[(1S,2S)-2-(heptylamino)cyclohexyl]heptanoic acid |
|---|---|
| PubChem CID | 163408640 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | 7-[(1S,2S)-2-(heptylamino)cyclohexyl]heptanoic acid |
| SMILES | CCCCCCCN[C@H]1CCCC[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H39NO2/c1-2-3-4-7-12-17-21-19-15-11-10-14-18(19)13-8-5-6-9-16-20(22)23/h18-19,21H,2-17H2,1H3,(H,22,23)/t18-,19-/m0/s1 |
| InChIKey | CQLVUICBMPWVOR-OALUTQOASA-N |
| XLogP | 5.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|