C6H8N2OS — CID 163410741
3-methylsulfanyl-1H-1,3-diazepin-2-one (PubChem CID 163410741) has the molecular formula C6H8N2OS and a molecular weight of 156.21 g/mol. Its IUPAC name is 3-methylsulfanyl-1H-1,3-diazepin-2-one.
| Compound Name | 3-methylsulfanyl-1H-1,3-diazepin-2-one |
|---|---|
| PubChem CID | 163410741 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 3-methylsulfanyl-1H-1,3-diazepin-2-one |
| SMILES | CSN1C=CC=CNC1=O |
| InChI | InChI=1S/C6H8N2OS/c1-10-8-5-3-2-4-7-6(8)9/h2-5H,1H3,(H,7,9) |
| InChIKey | AAGUATLRIYVAOA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|