C10H15BrN2O2 — CID 163411661
4-bromo-1-N-tert-butyl-2-N,2-N-dihydroxybenzene-1,2-diamine (PubChem CID 163411661) has the molecular formula C10H15BrN2O2 and a molecular weight of 275.15 g/mol. Its IUPAC name is 4-bromo-1-N-tert-butyl-2-N,2-N-dihydroxybenzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-tert-butyl-2-N,2-N-dihydroxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 163411661 |
| Molecular Formula | C10H15BrN2O2 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 4-bromo-1-N-tert-butyl-2-N,2-N-dihydroxybenzene-1,2-diamine |
| SMILES | CC(C)(C)Nc1ccc(Br)cc1N(O)O |
| InChI | InChI=1S/C10H15BrN2O2/c1-10(2,3)12-8-5-4-7(11)6-9(8)13(14)15/h4-6,12,14-15H,1-3H3 |
| InChIKey | AAZYJWFMGQQZGQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|