C10H14ClN3 — CID 163413623
1-(6-chloro-5-ethyl-2-pyridinyl)azetidin-3-amine (PubChem CID 163413623) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 1-(6-chloro-5-ethyl-2-pyridinyl)azetidin-3-amine.
| Compound Name | 1-(6-chloro-5-ethyl-2-pyridinyl)azetidin-3-amine |
|---|---|
| PubChem CID | 163413623 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 1-(6-chloro-5-ethyl-2-pyridinyl)azetidin-3-amine |
| SMILES | CCc1ccc(N2CC(N)C2)nc1Cl |
| InChI | InChI=1S/C10H14ClN3/c1-2-7-3-4-9(13-10(7)11)14-5-8(12)6-14/h3-4,8H,2,5-6,12H2,1H3 |
| InChIKey | ACOIPZNSWIWCKN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|