C27H41N5O3 — CID 163414314
N-[(2R)-2-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]carbamoyl]cyclohexylidene]-4-(4-propylpiperazin-1-yl)benzamide (PubChem CID 163414314) has the molecular formula C27H41N5O3 and a molecular weight of 483.66 g/mol. Its IUPAC name is N-[(2R)-2-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]carbamoyl]cyclohexylidene]-4-(4-propylpiperazin-1-yl)benzamide.
| Compound Name | N-[(2R)-2-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]carbamoyl]cyclohexylidene]-4-(4-propylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 163414314 |
| Molecular Formula | C27H41N5O3 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | N-[(2R)-2-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]carbamoyl]cyclohexylidene]-4-(4-propylpiperazin-1-yl)benzamide |
| SMILES | CCCN1CCN(c2ccc(C(=O)/N=C3\CCCC[C@H]3C(=O)N[C@@H](CC(C)C)C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C27H41N5O3/c1-4-13-31-14-16-32(17-15-31)21-11-9-20(10-12-21)26(34)29-23-8-6-5-7-22(23)27(35)30-24(25(28)33)18-19(2)3/h9-12,19,22,24H,4-8,13-18H2,1-3H3,(H2,28,33)(H,30,35)/b29-23+/t22-,24+/m1/s1 |
| InChIKey | ADBUWFVOFDWQNY-DNNAQKEGSA-N |
| XLogP | 3.01 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|