C6H14N2O4 — CID 163415035
2-amino-N-(1,3-dihydroxypropan-2-yloxy)propanamide (PubChem CID 163415035) has the molecular formula C6H14N2O4 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-amino-N-(1,3-dihydroxypropan-2-yloxy)propanamide.
| Compound Name | 2-amino-N-(1,3-dihydroxypropan-2-yloxy)propanamide |
|---|---|
| PubChem CID | 163415035 |
| Molecular Formula | C6H14N2O4 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-amino-N-(1,3-dihydroxypropan-2-yloxy)propanamide |
| SMILES | CC(N)C(=O)NOC(CO)CO |
| InChI | InChI=1S/C6H14N2O4/c1-4(7)6(11)8-12-5(2-9)3-10/h4-5,9-10H,2-3,7H2,1H3,(H,8,11) |
| InChIKey | ADQXDWWRQTWXRG-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|