About (2-aminopropanoylamino) propanoate
(2-aminopropanoylamino) propanoate (PubChem CID 146291069) has the molecular formula C6H12N2O3
and a molecular weight of 160.17 g/mol. Its IUPAC name is (2-aminopropanoylamino) propanoate.
Molecular Properties
| Compound Name | (2-aminopropanoylamino) propanoate |
| PubChem CID | 146291069 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | (2-aminopropanoylamino) propanoate |
| SMILES | CCC(=O)ONC(=O)C(C)N |
| InChI | InChI=1S/C6H12N2O3/c1-3-5(9)11-8-6(10)4(2)7/h4H,3,7H2,1-2H3,(H,8,10) |
| InChIKey | LVGCPBZZFFAJGC-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-aminopropanoylamino) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminopropanoylamino) propanoate?
The IUPAC name of (2-aminopropanoylamino) propanoate (CID 146291069) is (2-aminopropanoylamino) propanoate.
What is the SMILES notation for (2-aminopropanoylamino) propanoate?
The canonical SMILES for (2-aminopropanoylamino) propanoate is CCC(=O)ONC(=O)C(C)N.
What is the InChIKey of (2-aminopropanoylamino) propanoate?
The InChIKey is LVGCPBZZFFAJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3/c1-3-5(9)11-8-6(10)4(2)7/h4H,3,7H2,1-2H3,(H,8,10).
What are the key properties of (2-aminopropanoylamino) propanoate?
(2-aminopropanoylamino) propanoate has a molecular weight of 160.17 g/mol, XLogP of -0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminopropanoylamino) propanoate is sourced from PubChem (CID 146291069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).