About disodium;hydride;(propanoyloxyamino) propanoate
disodium;hydride;(propanoyloxyamino) propanoate (PubChem CID 175458235) has the molecular formula C6H13NNa2O4
and a molecular weight of 209.15 g/mol. Its IUPAC name is disodium;hydride;(propanoyloxyamino) propanoate.
Molecular Properties
| Compound Name | disodium;hydride;(propanoyloxyamino) propanoate |
| PubChem CID | 175458235 |
| Molecular Formula | C6H13NNa2O4 |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | disodium;hydride;(propanoyloxyamino) propanoate |
| SMILES | CCC(=O)ONOC(=O)CC.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C6H11NO4.2Na.2H/c1-3-5(8)10-7-11-6(9)4-2;;;;/h7H,3-4H2,1-2H3;;;;/q;2*+1;2*-1 |
| InChIKey | NZBICDWPZHZWRN-UHFFFAOYSA-N |
| XLogP | -5.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | -5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze disodium;hydride;(propanoyloxyamino) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;hydride;(propanoyloxyamino) propanoate?
The IUPAC name of disodium;hydride;(propanoyloxyamino) propanoate (CID 175458235) is disodium;hydride;(propanoyloxyamino) propanoate.
What is the SMILES notation for disodium;hydride;(propanoyloxyamino) propanoate?
The canonical SMILES for disodium;hydride;(propanoyloxyamino) propanoate is CCC(=O)ONOC(=O)CC.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;hydride;(propanoyloxyamino) propanoate?
The InChIKey is NZBICDWPZHZWRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4.2Na.2H/c1-3-5(8)10-7-11-6(9)4-2;;;;/h7H,3-4H2,1-2H3;;;;/q;2*+1;2*-1.
What are the key properties of disodium;hydride;(propanoyloxyamino) propanoate?
disodium;hydride;(propanoyloxyamino) propanoate has a molecular weight of 209.15 g/mol, XLogP of -5.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;hydride;(propanoyloxyamino) propanoate is sourced from PubChem (CID 175458235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).