About (2-ethylhydrazinyl) propanoate
(2-ethylhydrazinyl) propanoate (PubChem CID 140581443) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is (2-ethylhydrazinyl) propanoate.
Molecular Properties
| Compound Name | (2-ethylhydrazinyl) propanoate |
| PubChem CID | 140581443 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (2-ethylhydrazinyl) propanoate |
| SMILES | CCNNOC(=O)CC |
| InChI | InChI=1S/C5H12N2O2/c1-3-5(8)9-7-6-4-2/h6-7H,3-4H2,1-2H3 |
| InChIKey | RZYUPQYYWLKEAC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-ethylhydrazinyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylhydrazinyl) propanoate?
The IUPAC name of (2-ethylhydrazinyl) propanoate (CID 140581443) is (2-ethylhydrazinyl) propanoate.
What is the SMILES notation for (2-ethylhydrazinyl) propanoate?
The canonical SMILES for (2-ethylhydrazinyl) propanoate is CCNNOC(=O)CC.
What is the InChIKey of (2-ethylhydrazinyl) propanoate?
The InChIKey is RZYUPQYYWLKEAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c1-3-5(8)9-7-6-4-2/h6-7H,3-4H2,1-2H3.
What are the key properties of (2-ethylhydrazinyl) propanoate?
(2-ethylhydrazinyl) propanoate has a molecular weight of 132.16 g/mol, XLogP of -0.03, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylhydrazinyl) propanoate is sourced from PubChem (CID 140581443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).