About sodium;formamido propanoate;hydride
sodium;formamido propanoate;hydride (PubChem CID 174830035) has the molecular formula C4H8NNaO3
and a molecular weight of 141.10 g/mol. Its IUPAC name is sodium;formamido propanoate;hydride.
Molecular Properties
| Compound Name | sodium;formamido propanoate;hydride |
| PubChem CID | 174830035 |
| Molecular Formula | C4H8NNaO3 |
| Molecular Weight | 141.10 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | sodium;formamido propanoate;hydride |
| SMILES | CCC(=O)ONC=O.[H-].[Na+] |
| InChI | InChI=1S/C4H7NO3.Na.H/c1-2-4(7)8-5-3-6;;/h3H,2H2,1H3,(H,5,6);;/q;+1;-1 |
| InChIKey | JARAFWRWCJJUMF-UHFFFAOYSA-N |
| XLogP | -3.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.10 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;formamido propanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;formamido propanoate;hydride?
The IUPAC name of sodium;formamido propanoate;hydride (CID 174830035) is sodium;formamido propanoate;hydride.
What is the SMILES notation for sodium;formamido propanoate;hydride?
The canonical SMILES for sodium;formamido propanoate;hydride is CCC(=O)ONC=O.[H-].[Na+].
What is the InChIKey of sodium;formamido propanoate;hydride?
The InChIKey is JARAFWRWCJJUMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO3.Na.H/c1-2-4(7)8-5-3-6;;/h3H,2H2,1H3,(H,5,6);;/q;+1;-1.
What are the key properties of sodium;formamido propanoate;hydride?
sodium;formamido propanoate;hydride has a molecular weight of 141.10 g/mol, XLogP of -3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;formamido propanoate;hydride is sourced from PubChem (CID 174830035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).