C27H43N5O3 — CID 163415661
(2S)-4-amino-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-4-ethyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide (PubChem CID 163415661) has the molecular formula C27H43N5O3 and a molecular weight of 485.67 g/mol. Its IUPAC name is (2S)-4-amino-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-4-ethyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-4-amino-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-4-ethyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163415661 |
| Molecular Formula | C27H43N5O3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | (2S)-4-amino-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-4-ethyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide |
| SMILES | CCC1(N)C[C@@H](C(=O)N[C@@H]2CCCc3ccccc32)N(C(=O)[C@@H](NC(=O)[C@H](C)NC)C(C)(C)C)C1 |
| InChI | InChI=1S/C27H43N5O3/c1-7-27(28)15-21(24(34)30-20-14-10-12-18-11-8-9-13-19(18)20)32(16-27)25(35)22(26(3,4)5)31-23(33)17(2)29-6/h8-9,11,13,17,20-22,29H,7,10,12,14-16,28H2,1-6H3,(H,30,34)(H,31,33)/t17-,20+,21-,22+,27?/m0/s1 |
| InChIKey | AEDXOKJCURPQGQ-RYJAIGQDSA-N |
| XLogP | 2.03 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |