C10H10FIN2O3 — CID 163416310
1-[(2R)-3-fluoro-5-(iodomethyl)-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 163416310) has the molecular formula C10H10FIN2O3 and a molecular weight of 352.10 g/mol. Its IUPAC name is 1-[(2R)-3-fluoro-5-(iodomethyl)-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R)-3-fluoro-5-(iodomethyl)-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163416310 |
| Molecular Formula | C10H10FIN2O3 |
| Molecular Weight | 352.10 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 1-[(2R)-3-fluoro-5-(iodomethyl)-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2OC(CI)=CC2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H10FIN2O3/c1-5-4-14(10(16)13-8(5)15)9-7(11)2-6(3-12)17-9/h2,4,7,9H,3H2,1H3,(H,13,15,16)/t7?,9-/m1/s1 |
| InChIKey | AESGFDBFOBBELV-NHSZFOGYSA-N |
| XLogP | 1.03 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.10 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|