C22H18F3N3O3 — CID 163418669
(2R)-N-ethenyl-2-[1-oxo-5-[[2-(2,4,5-trifluorophenyl)acetyl]amino]isoquinolin-2-yl]propanamide (PubChem CID 163418669) has the molecular formula C22H18F3N3O3 and a molecular weight of 429.40 g/mol. Its IUPAC name is (2R)-N-ethenyl-2-[1-oxo-5-[[2-(2,4,5-trifluorophenyl)acetyl]amino]isoquinolin-2-yl]propanamide.
| Compound Name | (2R)-N-ethenyl-2-[1-oxo-5-[[2-(2,4,5-trifluorophenyl)acetyl]amino]isoquinolin-2-yl]propanamide |
|---|---|
| PubChem CID | 163418669 |
| Molecular Formula | C22H18F3N3O3 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (2R)-N-ethenyl-2-[1-oxo-5-[[2-(2,4,5-trifluorophenyl)acetyl]amino]isoquinolin-2-yl]propanamide |
| SMILES | C=CNC(=O)[C@@H](C)n1ccc2c(NC(=O)Cc3cc(F)c(F)cc3F)cccc2c1=O |
| InChI | InChI=1S/C22H18F3N3O3/c1-3-26-21(30)12(2)28-8-7-14-15(22(28)31)5-4-6-19(14)27-20(29)10-13-9-17(24)18(25)11-16(13)23/h3-9,11-12H,1,10H2,2H3,(H,26,30)(H,27,29)/t12-/m1/s1 |
| InChIKey | AGPIUYBMSCGRMN-GFCCVEGCSA-N |
| XLogP | 3.42 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|