C21H18F3N3O4 — CID 58973982
2-[1-oxo-5-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]isoquinolin-2-yl]propanamide (PubChem CID 58973982) has the molecular formula C21H18F3N3O4 and a molecular weight of 433.39 g/mol. Its IUPAC name is 2-[1-oxo-5-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]isoquinolin-2-yl]propanamide.
| Compound Name | 2-[1-oxo-5-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]isoquinolin-2-yl]propanamide |
|---|---|
| PubChem CID | 58973982 |
| Molecular Formula | C21H18F3N3O4 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[1-oxo-5-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]isoquinolin-2-yl]propanamide |
| SMILES | CC(C(N)=O)n1ccc2c(NC(=O)Cc3ccc(OC(F)(F)F)cc3)cccc2c1=O |
| InChI | InChI=1S/C21H18F3N3O4/c1-12(19(25)29)27-10-9-15-16(20(27)30)3-2-4-17(15)26-18(28)11-13-5-7-14(8-6-13)31-21(22,23)24/h2-10,12H,11H2,1H3,(H2,25,29)(H,26,28) |
| InChIKey | QCULFGZSGIWZKW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |