C7H14N2O2S — CID 163421018
(2E,4E)-4-amino-2-methylhexa-2,4-diene-1-sulfonamide (PubChem CID 163421018) has the molecular formula C7H14N2O2S and a molecular weight of 190.27 g/mol. Its IUPAC name is (2E,4E)-4-amino-2-methylhexa-2,4-diene-1-sulfonamide.
| Compound Name | (2E,4E)-4-amino-2-methylhexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 163421018 |
| Molecular Formula | C7H14N2O2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (2E,4E)-4-amino-2-methylhexa-2,4-diene-1-sulfonamide |
| SMILES | C/C=C(N)\C=C(/C)CS(N)(=O)=O |
| InChI | InChI=1S/C7H14N2O2S/c1-3-7(8)4-6(2)5-12(9,10)11/h3-4H,5,8H2,1-2H3,(H2,9,10,11)/b6-4+,7-3+ |
| InChIKey | AILXCDPNCUPTMJ-DVFLZCIWSA-N |
| XLogP | 0.08 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|