C7H16N2O3S — CID 139520568
N-tert-butyl-N-methyl-2-sulfamoylacetamide (PubChem CID 139520568) has the molecular formula C7H16N2O3S and a molecular weight of 208.28 g/mol. Its IUPAC name is N-tert-butyl-N-methyl-2-sulfamoylacetamide.
| Compound Name | N-tert-butyl-N-methyl-2-sulfamoylacetamide |
|---|---|
| PubChem CID | 139520568 |
| Molecular Formula | C7H16N2O3S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | N-tert-butyl-N-methyl-2-sulfamoylacetamide |
| SMILES | CN(C(=O)CS(N)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C7H16N2O3S/c1-7(2,3)9(4)6(10)5-13(8,11)12/h5H2,1-4H3,(H2,8,11,12) |
| InChIKey | YQISPDFZERZKGS-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |