C8H17NO3S — CID 160633939
3,3,4-trimethyl-2-oxopentane-1-sulfonamide (PubChem CID 160633939) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is 3,3,4-trimethyl-2-oxopentane-1-sulfonamide.
| Compound Name | 3,3,4-trimethyl-2-oxopentane-1-sulfonamide |
|---|---|
| PubChem CID | 160633939 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 3,3,4-trimethyl-2-oxopentane-1-sulfonamide |
| SMILES | CC(C)C(C)(C)C(=O)CS(N)(=O)=O |
| InChI | InChI=1S/C8H17NO3S/c1-6(2)8(3,4)7(10)5-13(9,11)12/h6H,5H2,1-4H3,(H2,9,11,12) |
| InChIKey | RIHBAACCEXZKNR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |