C15H30O — CID 161336614
2,3,3,10-tetramethylundecan-4-one (PubChem CID 161336614) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is 2,3,3,10-tetramethylundecan-4-one.
| Compound Name | 2,3,3,10-tetramethylundecan-4-one |
|---|---|
| PubChem CID | 161336614 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 2,3,3,10-tetramethylundecan-4-one |
| SMILES | CC(C)CCCCCC(=O)C(C)(C)C(C)C |
| InChI | InChI=1S/C15H30O/c1-12(2)10-8-7-9-11-14(16)15(5,6)13(3)4/h12-13H,7-11H2,1-6H3 |
| InChIKey | YODBIBPXTDPNEU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|