C25H38ClNO5 — CID 163424371
7-chloro-N-[(4-hexyl-2-methoxycyclohexyl)methyl]-6-methoxy-3,4-dihydro-2H-1,5-benzodioxepine-9-carboxamide (PubChem CID 163424371) has the molecular formula C25H38ClNO5 and a molecular weight of 468.03 g/mol. Its IUPAC name is 7-chloro-N-[(4-hexyl-2-methoxycyclohexyl)methyl]-6-methoxy-3,4-dihydro-2H-1,5-benzodioxepine-9-carboxamide.
| Compound Name | 7-chloro-N-[(4-hexyl-2-methoxycyclohexyl)methyl]-6-methoxy-3,4-dihydro-2H-1,5-benzodioxepine-9-carboxamide |
|---|---|
| PubChem CID | 163424371 |
| Molecular Formula | C25H38ClNO5 |
| Molecular Weight | 468.03 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 7-chloro-N-[(4-hexyl-2-methoxycyclohexyl)methyl]-6-methoxy-3,4-dihydro-2H-1,5-benzodioxepine-9-carboxamide |
| SMILES | CCCCCCC1CCC(CNC(=O)c2cc(Cl)c(OC)c3c2OCCCO3)C(OC)C1 |
| InChI | InChI=1S/C25H38ClNO5/c1-4-5-6-7-9-17-10-11-18(21(14-17)29-2)16-27-25(28)19-15-20(26)23(30-3)24-22(19)31-12-8-13-32-24/h15,17-18,21H,4-14,16H2,1-3H3,(H,27,28) |
| InChIKey | ALEUXSOXVGRQBU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.03 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|