C26H32ClNO2 — CID 163426388
1-[2-chloro-4-[3-(1-cyclohexylpiperidin-4-yl)-4-methoxyphenyl]phenyl]ethanone (PubChem CID 163426388) has the molecular formula C26H32ClNO2 and a molecular weight of 426.00 g/mol. Its IUPAC name is 1-[2-chloro-4-[3-(1-cyclohexylpiperidin-4-yl)-4-methoxyphenyl]phenyl]ethanone.
| Compound Name | 1-[2-chloro-4-[3-(1-cyclohexylpiperidin-4-yl)-4-methoxyphenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 163426388 |
| Molecular Formula | C26H32ClNO2 |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 1-[2-chloro-4-[3-(1-cyclohexylpiperidin-4-yl)-4-methoxyphenyl]phenyl]ethanone |
| SMILES | COc1ccc(-c2ccc(C(C)=O)c(Cl)c2)cc1C1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C26H32ClNO2/c1-18(29)23-10-8-21(17-25(23)27)20-9-11-26(30-2)24(16-20)19-12-14-28(15-13-19)22-6-4-3-5-7-22/h8-11,16-17,19,22H,3-7,12-15H2,1-2H3 |
| InChIKey | AMWQUPLTRXMSLO-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |