C31H35N3O3 — CID 10255319
3-[4-[[3-(1-cyclopentylpiperidin-4-yl)-4-methoxyphenyl]carbamoyl]phenyl]benzamide (PubChem CID 10255319) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is 3-[4-[[3-(1-cyclopentylpiperidin-4-yl)-4-methoxyphenyl]carbamoyl]phenyl]benzamide.
| Compound Name | 3-[4-[[3-(1-cyclopentylpiperidin-4-yl)-4-methoxyphenyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 10255319 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | 3-[4-[[3-(1-cyclopentylpiperidin-4-yl)-4-methoxyphenyl]carbamoyl]phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3cccc(C(N)=O)c3)cc2)cc1C1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C31H35N3O3/c1-37-29-14-13-26(20-28(29)22-15-17-34(18-16-22)27-7-2-3-8-27)33-31(36)23-11-9-21(10-12-23)24-5-4-6-25(19-24)30(32)35/h4-6,9-14,19-20,22,27H,2-3,7-8,15-18H2,1H3,(H2,32,35)(H,33,36) |
| InChIKey | JNVHDINWTVEODM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |