C19H21BrN2O2 — CID 54192702
4-bromo-N-[4-methoxy-3-(1-methylpyrrolidin-3-yl)phenyl]benzamide (PubChem CID 54192702) has the molecular formula C19H21BrN2O2 and a molecular weight of 389.29 g/mol. Its IUPAC name is 4-bromo-N-[4-methoxy-3-(1-methylpyrrolidin-3-yl)phenyl]benzamide.
| Compound Name | 4-bromo-N-[4-methoxy-3-(1-methylpyrrolidin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 54192702 |
| Molecular Formula | C19H21BrN2O2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-bromo-N-[4-methoxy-3-(1-methylpyrrolidin-3-yl)phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Br)cc2)cc1C1CCN(C)C1 |
| InChI | InChI=1S/C19H21BrN2O2/c1-22-10-9-14(12-22)17-11-16(7-8-18(17)24-2)21-19(23)13-3-5-15(20)6-4-13/h3-8,11,14H,9-10,12H2,1-2H3,(H,21,23) |
| InChIKey | PJQCERDLSCBTNP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |