C32H40N4O3 — CID 70218996
N-[3-(dimethylamino)propyl]-4-[4-[[4-methoxy-3-(1-methylpyrrolidin-3-yl)phenyl]carbamoyl]phenyl]-3-methylbenzamide (PubChem CID 70218996) has the molecular formula C32H40N4O3 and a molecular weight of 528.70 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[4-[[4-methoxy-3-(1-methylpyrrolidin-3-yl)phenyl]carbamoyl]phenyl]-3-methylbenzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[4-[[4-methoxy-3-(1-methylpyrrolidin-3-yl)phenyl]carbamoyl]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 70218996 |
| Molecular Formula | C32H40N4O3 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[4-[[4-methoxy-3-(1-methylpyrrolidin-3-yl)phenyl]carbamoyl]phenyl]-3-methylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3ccc(C(=O)NCCCN(C)C)cc3C)cc2)cc1C1CCN(C)C1 |
| InChI | InChI=1S/C32H40N4O3/c1-22-19-25(31(37)33-16-6-17-35(2)3)11-13-28(22)23-7-9-24(10-8-23)32(38)34-27-12-14-30(39-5)29(20-27)26-15-18-36(4)21-26/h7-14,19-20,26H,6,15-18,21H2,1-5H3,(H,33,37)(H,34,38) |
| InChIKey | PHPRLMFVQVRGBL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|