C28H33N3O4 — CID 23204979
N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]-4-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-methylphenyl]benzamide (PubChem CID 23204979) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]-4-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-methylphenyl]benzamide.
| Compound Name | N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]-4-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 23204979 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]-4-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-methylphenyl]benzamide |
| SMILES | CO/N=C(\C)c1ccc(-c2ccc(C(=O)Nc3ccc(OC)c(OCCN(C)C)c3)cc2)c(C)c1 |
| InChI | InChI=1S/C28H33N3O4/c1-19-17-23(20(2)30-34-6)11-13-25(19)21-7-9-22(10-8-21)28(32)29-24-12-14-26(33-5)27(18-24)35-16-15-31(3)4/h7-14,17-18H,15-16H2,1-6H3,(H,29,32)/b30-20+ |
| InChIKey | PWZWROZAVGPOAS-TWKHWXDSSA-N |
| XLogP | 5.23 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|