C26H37NO2S — CID 143235233
ethane;4-[2-methoxy-5-(4-methylsulfanylphenyl)phenyl]-1-(oxan-4-yl)piperidine (PubChem CID 143235233) has the molecular formula C26H37NO2S and a molecular weight of 427.65 g/mol. Its IUPAC name is ethane;4-[2-methoxy-5-(4-methylsulfanylphenyl)phenyl]-1-(oxan-4-yl)piperidine.
| Compound Name | ethane;4-[2-methoxy-5-(4-methylsulfanylphenyl)phenyl]-1-(oxan-4-yl)piperidine |
|---|---|
| PubChem CID | 143235233 |
| Molecular Formula | C26H37NO2S |
| Molecular Weight | 427.65 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | ethane;4-[2-methoxy-5-(4-methylsulfanylphenyl)phenyl]-1-(oxan-4-yl)piperidine |
| SMILES | CC.COc1ccc(-c2ccc(SC)cc2)cc1C1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C24H31NO2S.C2H6/c1-26-24-8-5-20(18-3-6-22(28-2)7-4-18)17-23(24)19-9-13-25(14-10-19)21-11-15-27-16-12-21;1-2/h3-8,17,19,21H,9-16H2,1-2H3;1-2H3 |
| InChIKey | MYMYSXLKSKJDRD-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.65 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |