C17H25NO3 — CID 95135764
(3R)-3-(2,5-dimethoxyphenyl)-1-(oxan-4-yl)pyrrolidine (PubChem CID 95135764) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (3R)-3-(2,5-dimethoxyphenyl)-1-(oxan-4-yl)pyrrolidine.
| Compound Name | (3R)-3-(2,5-dimethoxyphenyl)-1-(oxan-4-yl)pyrrolidine |
|---|---|
| PubChem CID | 95135764 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (3R)-3-(2,5-dimethoxyphenyl)-1-(oxan-4-yl)pyrrolidine |
| SMILES | COc1ccc(OC)c([C@H]2CCN(C3CCOCC3)C2)c1 |
| InChI | InChI=1S/C17H25NO3/c1-19-15-3-4-17(20-2)16(11-15)13-5-8-18(12-13)14-6-9-21-10-7-14/h3-4,11,13-14H,5-10,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | NIPCJJQCNQRGOI-ZDUSSCGKSA-N |
| XLogP | 2.67 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |