C22H33NO2 — CID 70795090
1-[(1S,6S)-2-bicyclo[4.2.1]nonanyl]-4-(2,5-dimethoxyphenyl)piperidine (PubChem CID 70795090) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-[(1S,6S)-2-bicyclo[4.2.1]nonanyl]-4-(2,5-dimethoxyphenyl)piperidine.
| Compound Name | 1-[(1S,6S)-2-bicyclo[4.2.1]nonanyl]-4-(2,5-dimethoxyphenyl)piperidine |
|---|---|
| PubChem CID | 70795090 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 1-[(1S,6S)-2-bicyclo[4.2.1]nonanyl]-4-(2,5-dimethoxyphenyl)piperidine |
| SMILES | COc1ccc(OC)c(C2CCN(C3CCC[C@H]4CC[C@H]3C4)CC2)c1 |
| InChI | InChI=1S/C22H33NO2/c1-24-19-8-9-22(25-2)20(15-19)17-10-12-23(13-11-17)21-5-3-4-16-6-7-18(21)14-16/h8-9,15-18,21H,3-7,10-14H2,1-2H3/t16-,18-,21?/m0/s1 |
| InChIKey | RENMFYKRBSNVNC-UDWUOZNQSA-N |
| XLogP | 4.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |