C26H33NO2 — CID 11703842
1-[(2R)-2-bicyclo[2.2.1]heptanyl]-4-[2-methoxy-5-(2-methoxyphenyl)phenyl]piperidine (PubChem CID 11703842) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-[(2R)-2-bicyclo[2.2.1]heptanyl]-4-[2-methoxy-5-(2-methoxyphenyl)phenyl]piperidine.
| Compound Name | 1-[(2R)-2-bicyclo[2.2.1]heptanyl]-4-[2-methoxy-5-(2-methoxyphenyl)phenyl]piperidine |
|---|---|
| PubChem CID | 11703842 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 1-[(2R)-2-bicyclo[2.2.1]heptanyl]-4-[2-methoxy-5-(2-methoxyphenyl)phenyl]piperidine |
| SMILES | COc1ccccc1-c1ccc(OC)c(C2CCN([C@@H]3CC4CCC3C4)CC2)c1 |
| InChI | InChI=1S/C26H33NO2/c1-28-25-6-4-3-5-22(25)20-9-10-26(29-2)23(17-20)19-11-13-27(14-12-19)24-16-18-7-8-21(24)15-18/h3-6,9-10,17-19,21,24H,7-8,11-16H2,1-2H3/t18?,21?,24-/m1/s1 |
| InChIKey | HPKGBJGLWMVPRL-SXKUEDQZSA-N |
| XLogP | 5.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |