C27H35NO3S — CID 58772228
1-(2-bicyclo[2.2.1]heptanyl)-4-[5-(4-ethylsulfonylphenyl)-2-methoxyphenyl]piperidine (PubChem CID 58772228) has the molecular formula C27H35NO3S and a molecular weight of 453.65 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-4-[5-(4-ethylsulfonylphenyl)-2-methoxyphenyl]piperidine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-[5-(4-ethylsulfonylphenyl)-2-methoxyphenyl]piperidine |
|---|---|
| PubChem CID | 58772228 |
| Molecular Formula | C27H35NO3S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-[5-(4-ethylsulfonylphenyl)-2-methoxyphenyl]piperidine |
| SMILES | CCS(=O)(=O)c1ccc(-c2ccc(OC)c(C3CCN(C4CC5CCC4C5)CC3)c2)cc1 |
| InChI | InChI=1S/C27H35NO3S/c1-3-32(29,30)24-9-6-20(7-10-24)22-8-11-27(31-2)25(18-22)21-12-14-28(15-13-21)26-17-19-4-5-23(26)16-19/h6-11,18-19,21,23,26H,3-5,12-17H2,1-2H3 |
| InChIKey | OFORWXYPZZZNNQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |