C20H29NO2 — CID 58772326
1-[(1S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(2,5-dimethoxyphenyl)piperidine (PubChem CID 58772326) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-[(1S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(2,5-dimethoxyphenyl)piperidine.
| Compound Name | 1-[(1S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(2,5-dimethoxyphenyl)piperidine |
|---|---|
| PubChem CID | 58772326 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 1-[(1S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(2,5-dimethoxyphenyl)piperidine |
| SMILES | COc1ccc(OC)c(C2CCN(C3C[C@H]4CC[C@H]3C4)CC2)c1 |
| InChI | InChI=1S/C20H29NO2/c1-22-17-5-6-20(23-2)18(13-17)15-7-9-21(10-8-15)19-12-14-3-4-16(19)11-14/h5-6,13-16,19H,3-4,7-12H2,1-2H3/t14-,16-,19?/m0/s1 |
| InChIKey | FVAYUKMPSMPAMQ-QAQDEBIESA-N |
| XLogP | 4.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |