C23H39NO5 — CID 163428475
3-(3-butoxy-3-methylbutoxy)-N-(2-hydroxyethyl)-5-(3-methylbutoxy)benzamide (PubChem CID 163428475) has the molecular formula C23H39NO5 and a molecular weight of 409.57 g/mol. Its IUPAC name is 3-(3-butoxy-3-methylbutoxy)-N-(2-hydroxyethyl)-5-(3-methylbutoxy)benzamide.
| Compound Name | 3-(3-butoxy-3-methylbutoxy)-N-(2-hydroxyethyl)-5-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 163428475 |
| Molecular Formula | C23H39NO5 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | 3-(3-butoxy-3-methylbutoxy)-N-(2-hydroxyethyl)-5-(3-methylbutoxy)benzamide |
| SMILES | CCCCOC(C)(C)CCOc1cc(OCCC(C)C)cc(C(=O)NCCO)c1 |
| InChI | InChI=1S/C23H39NO5/c1-6-7-12-29-23(4,5)9-14-28-21-16-19(22(26)24-10-11-25)15-20(17-21)27-13-8-18(2)3/h15-18,25H,6-14H2,1-5H3,(H,24,26) |
| InChIKey | AONHWPNRAFPHMW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|