C20H26N2O8 — CID 163429596
(2S)-2-[2-(1,3-dioxoisoindol-2-yl)oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-propan-2-yloxyacetic acid (PubChem CID 163429596) has the molecular formula C20H26N2O8 and a molecular weight of 422.43 g/mol. Its IUPAC name is (2S)-2-[2-(1,3-dioxoisoindol-2-yl)oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-propan-2-yloxyacetic acid.
| Compound Name | (2S)-2-[2-(1,3-dioxoisoindol-2-yl)oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-propan-2-yloxyacetic acid |
|---|---|
| PubChem CID | 163429596 |
| Molecular Formula | C20H26N2O8 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (2S)-2-[2-(1,3-dioxoisoindol-2-yl)oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-propan-2-yloxyacetic acid |
| SMILES | CC(C)O[C@@H](C(=O)O)N(CCON1C(=O)c2ccccc2C1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H26N2O8/c1-12(2)29-17(18(25)26)21(19(27)30-20(3,4)5)10-11-28-22-15(23)13-8-6-7-9-14(13)16(22)24/h6-9,12,17H,10-11H2,1-5H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | APJFLSGZLFWWBS-KRWDZBQOSA-N |
| XLogP | 2.29 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|