C18H24N2O4 — CID 130871466
tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)propan-2-yl]-N-ethylcarbamate (PubChem CID 130871466) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)propan-2-yl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)propan-2-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 130871466 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)propan-2-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)C(C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H24N2O4/c1-6-19(17(23)24-18(3,4)5)12(2)11-20-15(21)13-9-7-8-10-14(13)16(20)22/h7-10,12H,6,11H2,1-5H3 |
| InChIKey | DUMBMUJASIOAPM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|