C8H14N4O — CID 163432843
6-methyl-4,5,6,7,8,10-hexahydro-1H-imidazo[4,5-g][1,3,6]oxadiazonine (PubChem CID 163432843) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 6-methyl-4,5,6,7,8,10-hexahydro-1H-imidazo[4,5-g][1,3,6]oxadiazonine.
| Compound Name | 6-methyl-4,5,6,7,8,10-hexahydro-1H-imidazo[4,5-g][1,3,6]oxadiazonine |
|---|---|
| PubChem CID | 163432843 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 6-methyl-4,5,6,7,8,10-hexahydro-1H-imidazo[4,5-g][1,3,6]oxadiazonine |
| SMILES | CC1CNc2nc[nH]c2COCN1 |
| InChI | InChI=1S/C8H14N4O/c1-6-2-9-8-7(10-4-11-8)3-13-5-12-6/h4,6,9,12H,2-3,5H2,1H3,(H,10,11) |
| InChIKey | ARZCZPPRDBXQNT-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |