C28H42N3O3-3 — CID 163432970
6-methyl-1-N-[6-methyl-6-(N-oxidoanilino)heptyl]-1-N,6-N-dioxido-6-N-phenylheptane-1,6-diamine (PubChem CID 163432970) has the molecular formula C28H42N3O3-3 and a molecular weight of 468.66 g/mol. Its IUPAC name is 6-methyl-1-N-[6-methyl-6-(N-oxidoanilino)heptyl]-1-N,6-N-dioxido-6-N-phenylheptane-1,6-diamine.
| Compound Name | 6-methyl-1-N-[6-methyl-6-(N-oxidoanilino)heptyl]-1-N,6-N-dioxido-6-N-phenylheptane-1,6-diamine |
|---|---|
| PubChem CID | 163432970 |
| Molecular Formula | C28H42N3O3-3 |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 6-methyl-1-N-[6-methyl-6-(N-oxidoanilino)heptyl]-1-N,6-N-dioxido-6-N-phenylheptane-1,6-diamine |
| SMILES | CC(C)(CCCCCN([O-])CCCCCC(C)(C)N([O-])c1ccccc1)N([O-])c1ccccc1 |
| InChI | InChI=1S/C28H42N3O3/c1-27(2,30(33)25-17-9-5-10-18-25)21-13-7-15-23-29(32)24-16-8-14-22-28(3,4)31(34)26-19-11-6-12-20-26/h5-6,9-12,17-20H,7-8,13-16,21-24H2,1-4H3/q-3 |
| InChIKey | JEJDSCITDVDLLX-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|