C21H21FmN8O- — CID 163440864
4-(2-ethylbenzimidazol-1-yl)-6-morpholin-4-yl-N-pyridin-4-yl-1,3,5-triazin-2-amine;fermium (PubChem CID 163440864) has the molecular formula C21H21FmN8O- and a molecular weight of 658.45 g/mol. Its IUPAC name is 4-(2-ethylbenzimidazol-1-yl)-6-morpholin-4-yl-N-pyridin-4-yl-1,3,5-triazin-2-amine;fermium.
| Compound Name | 4-(2-ethylbenzimidazol-1-yl)-6-morpholin-4-yl-N-pyridin-4-yl-1,3,5-triazin-2-amine;fermium |
|---|---|
| PubChem CID | 163440864 |
| Molecular Formula | C21H21FmN8O- |
| Molecular Weight | 658.45 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | 4-(2-ethylbenzimidazol-1-yl)-6-morpholin-4-yl-N-pyridin-4-yl-1,3,5-triazin-2-amine;fermium |
| SMILES | C[CH-]c1nc2ccccc2n1-c1nc(Nc2ccncc2)nc(N2CCOCC2)n1.[Fm] |
| InChI | InChI=1S/C21H21N8O.Fm/c1-2-18-24-16-5-3-4-6-17(16)29(18)21-26-19(23-15-7-9-22-10-8-15)25-20(27-21)28-11-13-30-14-12-28;/h2-10H,11-14H2,1H3,(H,22,23,25,26,27);/q-1; |
| InChIKey | POLDUYPACMSGLJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|