C23H30N2O3 — CID 163442568
tert-butyl 4-[[3-[(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]oxyphenyl]methyl]piperazine-1-carboxylate (PubChem CID 163442568) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is tert-butyl 4-[[3-[(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]oxyphenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-[(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]oxyphenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 163442568 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | tert-butyl 4-[[3-[(3E,5Z)-hepta-3,5-dien-1-yn-4-yl]oxyphenyl]methyl]piperazine-1-carboxylate |
| SMILES | C#C/C=C(\C=C/C)Oc1cccc(CN2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C23H30N2O3/c1-6-9-20(10-7-2)27-21-12-8-11-19(17-21)18-24-13-15-25(16-14-24)22(26)28-23(3,4)5/h1,7-12,17H,13-16,18H2,2-5H3/b10-7-,20-9+ |
| InChIKey | AZTOYQXBPMVQSR-UPCWFAKJSA-N |
| XLogP | 4.21 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|