C21H30O6 — CID 163443965
[2-(1-cyclohexyloxyethoxy)-1,4-dioxospiro[4.5]decan-3-yl] prop-2-enoate (PubChem CID 163443965) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is [2-(1-cyclohexyloxyethoxy)-1,4-dioxospiro[4.5]decan-3-yl] prop-2-enoate.
| Compound Name | [2-(1-cyclohexyloxyethoxy)-1,4-dioxospiro[4.5]decan-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 163443965 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [2-(1-cyclohexyloxyethoxy)-1,4-dioxospiro[4.5]decan-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1C(=O)C2(CCCCC2)C(=O)C1OC(C)OC1CCCCC1 |
| InChI | InChI=1S/C21H30O6/c1-3-16(22)27-18-17(26-14(2)25-15-10-6-4-7-11-15)19(23)21(20(18)24)12-8-5-9-13-21/h3,14-15,17-18H,1,4-13H2,2H3 |
| InChIKey | BAXRRIXBMXIOSM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|