C21H11IN- — CID 163445758
7λ3-ioda-9-azanidahexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3(8),4,6,11,13,15,17,19,21-undecaene (PubChem CID 163445758) has the molecular formula C21H11IN- and a molecular weight of 404.23 g/mol. Its IUPAC name is 7λ3-ioda-9-azanidahexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3(8),4,6,11,13,15,17,19,21-undecaene.
| Compound Name | 7λ3-ioda-9-azanidahexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3(8),4,6,11,13,15,17,19,21-undecaene |
|---|---|
| PubChem CID | 163445758 |
| Molecular Formula | C21H11IN- |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 7λ3-ioda-9-azanidahexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3(8),4,6,11,13,15,17,19,21-undecaene |
| SMILES | C1=Cc2c([n-]c3cc4c5c(cccc5c23)-c2ccccc2-4)I=C1 |
| InChI | InChI=1S/C21H11IN/c1-2-6-13-12(5-1)14-7-3-8-15-19(14)17(13)11-18-20(15)16-9-4-10-22-21(16)23-18/h1-11H/q-1 |
| InChIKey | BCJGQGAMKFSANR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|