C51H28N6 — CID 163449231
4-carbazol-9-yl-3-[4-cyano-3-(11-phenylindolo[2,3-a]carbazol-12-yl)phenyl]-5-isocyanobenzonitrile (PubChem CID 163449231) has the molecular formula C51H28N6 and a molecular weight of 724.83 g/mol. Its IUPAC name is 4-carbazol-9-yl-3-[4-cyano-3-(11-phenylindolo[2,3-a]carbazol-12-yl)phenyl]-5-isocyanobenzonitrile.
| Compound Name | 4-carbazol-9-yl-3-[4-cyano-3-(11-phenylindolo[2,3-a]carbazol-12-yl)phenyl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 163449231 |
| Molecular Formula | C51H28N6 |
| Molecular Weight | 724.83 g/mol |
| Exact Mass | 724.24 |
| IUPAC Name | 4-carbazol-9-yl-3-[4-cyano-3-(11-phenylindolo[2,3-a]carbazol-12-yl)phenyl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc(C#N)c(-n3c4ccccc4c4ccc5c6ccccc6n(-c6ccccc6)c5c43)c2)c1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C51H28N6/c1-54-43-28-32(30-52)27-42(49(43)56-45-20-10-5-15-36(45)37-16-6-11-21-46(37)56)33-23-24-34(31-53)48(29-33)57-47-22-12-8-18-39(47)41-26-25-40-38-17-7-9-19-44(38)55(50(40)51(41)57)35-13-3-2-4-14-35/h2-29H |
| InChIKey | RXGGRXFFWLDIPU-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.83 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|